binacorbShers binacorbShers

04-07-2016
Health

contestada

All of the following are immune disorders except:
a. arthritis
b. asthma
c. hemophilia
d. multiple sclerosis

Respuesta :

pandamille pandamille

04-07-2016

All of the following are immune disorders except:

c. hemophilia

Answer Link

Otras preguntas

What were two main reasons that the French established colonies in the America

Can y’all help me find the slope

Photosynthesis can be broken down into two steps; the light and dark reactions. The dark reaction is also known as mo nga ana in certain the sun centenas bonnes

Solve for y. [tex]\frac{2}{3}+y-\frac{1}{9}=\frac{7}{9} \\[/tex] Enter your answer in the box. y =__

find the equation of a line m= -2, (0,10)

cosec(6b+pi/8)=sec(2b-pi/8)

Jessica must choose a number between 67 and 113 that is a multiple of 4, 9, and 12. Write all the numbers that she could choose. If there is more than one numb

How do you break apart the factor 12?

What criticism of American society did Thomas Cole have?

And our teacher has a box of 100 markers the teacher gives out silver markers to each student in the class and has 16 markers left over how many students are in